CymitQuimica logo

CAS 100508-57-4

:

2-Methoxy-4,6-bis(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine

Description:
2-Methoxy-4,6-bis(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine is a synthetic organic compound characterized by its triazine ring structure, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features methoxy and dinitroethoxy substituents, contributing to its unique chemical properties. The presence of fluorine atoms enhances its reactivity and potential applications in various fields, including agrochemicals and materials science. The dinitroethoxy groups are known for their explosive characteristics, indicating that this compound may exhibit energetic properties. Additionally, the methoxy group can influence solubility and polarity, affecting its behavior in different solvents. The compound's stability, reactivity, and potential toxicity are important considerations for handling and application. As with many nitrogen-containing compounds, it may also have implications in the synthesis of other chemical entities or in the development of novel materials. Proper safety measures should be observed due to its potential hazards associated with the dinitro groups.
Formula:C8H7F2N7O11
InChI:InChI=1/C8H7F2N7O11/c1-26-4-11-5(27-2-7(9,14(18)19)15(20)21)13-6(12-4)28-3-8(10,16(22)23)17(24)25/h2-3H2,1H3
SMILES:COc1nc(nc(n1)OCC(F)(N(=O)=O)N(=O)=O)OCC(F)(N(=O)=O)N(=O)=O
Synonyms:
  • 2,4-Bis(2-Fluoro-2,2-Dinitroethoxy)-6-Methoxy-1,3,5-Triazine
  • 2-Methoxy-4,6-bis(2-fluoro-2,2-dinitroethoxy)-1,3,5-triazine
Sort by
Found 1 products.