CymitQuimica logo

CAS 100510-66-5

:

6′-Aminospiro[cyclopentane-1,3′-[3H]indol]-2′(1′H)-one

Description:
6′-Aminospiro[cyclopentane-1,3′-[3H]indol]-2′(1′H)-one, with the CAS number 100510-66-5, is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopentane ring with an indole moiety. This compound features an amino group, which contributes to its potential reactivity and biological activity. The presence of the spiro configuration often imparts distinctive stereochemical properties, influencing its interactions with biological targets. The indole part of the molecule is known for its prevalence in various natural products and pharmaceuticals, often associated with diverse biological activities, including anti-inflammatory and anticancer properties. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure. As a synthetic compound, it may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications in various fields.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c13-8-3-4-9-10(7-8)14-11(15)12(9)5-1-2-6-12/h3-4,7H,1-2,5-6,13H2,(H,14,15)
InChI key:InChIKey=IHGQTAJGOPOWQT-UHFFFAOYSA-N
SMILES:O=C1C2(C=3C(N1)=CC(N)=CC3)CCCC2
Synonyms:
  • Spiro[cyclopentane-1,3′-[3H]indol]-2′(1′H)-one, 6′-amino-
  • 6′-Aminospiro[cyclopentane-1,3′-[3H]indol]-2′(1′H)-one
Found 4 products.