CymitQuimica logo

CAS 100511-00-0

:

2H-Indol-2-one, 1,3-dihydro-3,3-dimethyl-5-nitro-

Description:
2H-Indol-2-one, 1,3-dihydro-3,3-dimethyl-5-nitro- is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a nitro group at the 5-position and two methyl groups at the 3-position of the indole framework, contributing to its unique chemical properties. The presence of the nitro group typically enhances the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The dihydro form indicates that the compound has a saturated bond in the indole structure, which can influence its stability and reactivity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. As with many nitro-containing compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-10(2)7-5-6(12(14)15)3-4-8(7)11-9(10)13/h3-5H,1-2H3,(H,11,13)
InChI key:UMHSOWVJQJFESZ-UHFFFAOYSA-N
SMILES:CC1(C2=C(C=CC(=C2)[N+](=O)[O-])NC1=O)C
Found 3 products.