CAS 100516-76-5
:4-METHYL-1,3-THIAZOLE-2-CARBOHYDRAZIDE
Description:
4-Methyl-1,3-thiazole-2-carbohydrazide is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a hydrazide functional group, which is indicative of its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of hydrophilic functional groups. The methyl group on the thiazole ring can influence its electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. Compounds of this nature are often studied for their pharmacological properties, including antimicrobial and antifungal activities. Additionally, the presence of the thiazole moiety is associated with various applications in medicinal chemistry, agrochemicals, and dye synthesis. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C5H7N3OS
InChI:InChI=1S/C5H7N3OS/c1-3-2-10-5(7-3)4(9)8-6/h2H,6H2,1H3,(H,8,9)
InChI key:KRXWBFGOEMMEMO-UHFFFAOYSA-N
SMILES:CC1=CSC(=N1)C(=O)NN
Synonyms:- 2-Thiazolecarboxylicacid,4-methyl-,hydrazide(6CI,9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
