
CAS 100517-03-1
:4-Thiazolecarboxylicacid,5-methyl-,hydrazide(6CI)
Description:
4-Thiazolecarboxylic acid, 5-methyl-, hydrazide (CAS 100517-03-1) is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. This substance features a carboxylic acid functional group and a hydrazide moiety, contributing to its potential reactivity and biological activity. The presence of the methyl group at the 5-position of the thiazole ring influences its chemical properties, such as solubility and stability. Typically, compounds like this may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, making them of interest in pharmaceutical research. The hydrazide functional group can also participate in various chemical reactions, including condensation and hydrazone formation. Overall, 4-Thiazolecarboxylic acid, 5-methyl-, hydrazide is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C5H7N3OS
InChI:InChI=1S/C5H7N3OS/c1-3-4(5(9)8-6)7-2-10-3/h2H,6H2,1H3,(H,8,9)
InChI key:VHVHOUZISABZCA-UHFFFAOYSA-N
SMILES:CC1=C(N=CS1)C(=O)NN
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
