CAS 10052-47-8
:Triethylmethylammonium chloride
Description:
Triethylmethylammonium chloride, with the CAS number 10052-47-8, is a quaternary ammonium salt characterized by its structure, which includes three ethyl groups and one methyl group attached to a nitrogen atom, along with a chloride counterion. This compound is typically a white crystalline solid that is soluble in water and various organic solvents, making it useful in a range of applications. It exhibits properties typical of quaternary ammonium compounds, such as surface-active behavior and antimicrobial activity. Triethylmethylammonium chloride is often utilized in organic synthesis, as a phase transfer catalyst, and in the formulation of surfactants. Additionally, it can serve as a reagent in biochemical applications and is studied for its potential in drug delivery systems. Safety data indicates that, like many quaternary ammonium compounds, it should be handled with care due to potential irritant effects on skin and eyes. Proper storage and handling protocols are essential to ensure safety in laboratory and industrial settings.
Formula:C7H18N·Cl
InChI:InChI=1S/C7H18N.ClH/c1-5-8(4,6-2)7-3;/h5-7H2,1-4H3;1H/q+1;/p-1
InChI key:InChIKey=NIUZJTWSUGSWJI-UHFFFAOYSA-M
SMILES:[N+](CC)(CC)(CC)C.[Cl-]
Synonyms:- Ammonium, triethylmethyl-, chloride
- Ethanaminium, N,N-diethyl-N-methyl-, chloride
- Ethanaminium, N,N-diethyl-N-methyl-, chloride (1:1)
- Methyl Triethylammonium Chloride
- N,N,N-Triethyl-N-methylammonium chloride
- N,N-diethyl-N-methylethanaminium
- N,N-diethyl-N-methylethanaminium chloride
- Triethylmethylammonium chloride
- Methyltriethylammonium chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Triethylmethylammonium Chloride
CAS:Formula:C7H18ClNPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:151.68Triethylmethylammonium chloride, 98%
CAS:Effective phase transfer catalystFormula:C7H18ClNPurity:98%Color and Shape:White to pale cream, Crystalline powderMolecular weight:151.68Ethanaminium, N,N-diethyl-N-methyl-, chloride (1:1)
CAS:Formula:C7H18ClNPurity:98%Color and Shape:SolidMolecular weight:151.6775Triethylmethylammonium Chloride
CAS:Triethylmethylammonium ChlorideFormula:C7H18ClNPurity:98%Color and Shape:SolidMolecular weight:151.68Triethylmethylammonium chloride
CAS:Triethylmethylammonium chloride is a quaternary ammonium salt, classified as an alkylammonium salt. This compound is widely used as a phase-transfer catalyst in organic synthesis, facilitating the transfer of reactants between immiscible phases. Additionally, it serves as an electrolyte in electrochemical devices, a surfactant in emulsion polymerization, and a corrosion inhibitor. Its unique chemical properties make it an essential component in various industrial applications, including pharmaceuticals, agrochemicals, and materials science.Formula:C7H18ClNColor and Shape:SolidMolecular weight:151.68Triethylmethylammonium chloride
CAS:Triethylmethylammonium chloride is a disulfide bond forming agent that reacts with 4-benzoyloxybenzoic acid to produce an inorganic acid. It also reacts with the substrate film to form a nitrogen atom. This product has been used as a phase transition temperature indicator and as a probe for investigating the effects of thermal expansion on electrochemical impedance spectroscopy measurements. Triethylmethylammonium chloride has also been shown to cause acid formation from sodium carbonate, which can be used in the production of hydroxyl groups, amides or fatty acids.
Formula:C7H18ClNPurity:Min. 95%Color and Shape:PowderMolecular weight:151.68 g/molMethyltriethylammonium chloride
CAS:Formula:C7H18ClNPurity:99%Color and Shape:SolidMolecular weight:151.68Triethylmethylammonium Chloride
CAS:Controlled ProductApplications Triethylmethylammonium Chloride (cas# 10052-47-8) is a useful research chemical.
Formula:C7H18ClNColor and Shape:NeatMolecular weight:151.68







