CymitQuimica logo

CAS 1005205-25-3

:

1H-indazole-5-carbohydrazide

Description:
1H-Indazole-5-carbohydrazide is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a carbohydrazide functional group indicates that it contains a hydrazine derivative, which is linked to a carbonyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of hydrophilic functional groups. It may display biological activity, making it of interest in medicinal chemistry and drug development. The compound's structure allows for various chemical reactions, including potential derivatization, which can enhance its pharmacological properties. Additionally, 1H-indazole-5-carbohydrazide may participate in hydrogen bonding due to the presence of nitrogen and oxygen atoms, influencing its reactivity and interactions with other molecules. Overall, its unique structural features and functional groups contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H8N4O
InChI:InChI=1S/C8H8N4O/c9-11-8(13)5-1-2-7-6(3-5)4-10-12-7/h1-4H,9H2,(H,10,12)(H,11,13)
InChI key:FPIUWAAVOMKSTK-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C(=O)NN)C=NN2
Found 5 products.