CymitQuimica logo

CAS 1005206-17-6

:

7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid

Description:
7H-pyrrolo[2,3-d]pyrimidine-5-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and allows for potential reactivity in various chemical reactions, such as esterification or amidation. The presence of nitrogen atoms in the ring structure can influence its basicity and reactivity, making it a candidate for various biological and pharmaceutical applications. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. Its structural complexity and functional groups suggest potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents. As with many heterocycles, the compound's stability, reactivity, and interactions with biological targets can be influenced by substituents and the overall molecular environment. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-7(12)5-4-1-2-8-6(4)10-3-9-5/h1-3H,(H,11,12)(H,8,9,10)
InChI key:CSVBAOOXLRAOLW-UHFFFAOYSA-N
SMILES:C1=CNC2=NC=NC(=C21)C(=O)O
Found 4 products.