CAS 100523-83-9
:4-Bromo-2-iodopyridine
Description:
4-Bromo-2-iodopyridine is a heterocyclic organic compound characterized by the presence of both bromine and iodine substituents on a pyridine ring. Its molecular structure consists of a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and reactivity. The compound typically appears as a solid at room temperature and is soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic nature. 4-Bromo-2-iodopyridine is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various coupling reactions, such as Suzuki and Sonogashira reactions. The presence of both halogens enhances its reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to potential toxicity and environmental concerns.
Formula:C5H3BrIN
InChI:InChI=1/C5H3BrIN/c6-4-1-2-8-5(7)3-4/h1-3H
SMILES:c1cnc(cc1Br)I
Synonyms:- Pyridine, 4-Bromo-2-Iodo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Bromo-2-iodo-pyridine
CAS:4-Bromo-2-iodopyridine is a chemical compound that can be used in cross-coupling reactions. It has been shown to be an emissive compound, where the emission of light is due to the electron transition from a higher energy level to a lower one. 4-Bromo-2-iodopyridine is also conjugated, meaning that it contains alternating single and double bonds. The reactivity of this compound depends on its architecture, as dimers are more reactive than monomers.Formula:C5H3BrINPurity:Min. 95%Color and Shape:PowderMolecular weight:283.89 g/mol




