CymitQuimica logo

CAS 100527-50-2

:

2-(4-BROMOPHENYL)QUINAZOLINE-4(3H)-THIONE

Description:
2-(4-Bromophenyl)quinazoline-4(3H)-thione is a heterocyclic compound characterized by the presence of a quinazoline core, which is a bicyclic structure containing both benzene and pyrimidine rings. The compound features a bromine substituent at the para position of the phenyl group, which can influence its reactivity and biological activity. The thione functional group, characterized by a sulfur atom double-bonded to a carbon atom, contributes to the compound's potential as a ligand in coordination chemistry and may also impart unique properties in medicinal chemistry. This compound is of interest in various fields, including pharmaceuticals, due to its potential biological activities, such as antimicrobial or anticancer properties. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many heterocyclic compounds, the presence of the bromine atom may enhance lipophilicity, affecting its pharmacokinetics and interaction with biological targets. Safety and handling precautions should be observed, as with all chemical substances, particularly those with halogenated groups.
Formula:C14H9BrN2S
InChI:InChI=1/C14H9BrN2S/c15-10-7-5-9(6-8-10)13-16-12-4-2-1-3-11(12)14(18)17-13/h1-8H,(H,16,17,18)
InChI key:MKWVNTQJXOEFFY-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c(=S)nc(c1ccc(cc1)Br)[nH]2
Synonyms:
  • 2-(4-bromophenyl)quinazoline-4(1H)-thione
  • 2-(4-bromophenyl)quinazoline-4(3H)-thione
Found 2 products.