CAS 100537-30-2

1-PHENOXYPHTHALAZINE

Description:

1-Phenoxyphthalazine, with the CAS number 100537-30-2, is an organic compound characterized by its unique structure, which combines a phthalazine moiety with a phenoxy group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure contributes to its chemical properties, such as solubility in organic solvents and stability under standard conditions. 1-Phenoxyphthalazine may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Additionally, its reactivity can be influenced by the presence of functional groups, allowing for potential modifications to enhance its properties or efficacy. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 1-phenoxyphthalazine represents a versatile compound with potential utility in both industrial and research applications.

Formula: C₁₄H₁₀N₂O

InChI: InChI=1/C14H10N2O/c1-2-7-12(8-3-1)17-14-13-9-5-4-6-11(13)10-15-16-14/h1-10H

InChI key: CSHSXUZQMJVDJY-UHFFFAOYSA-N

SMILES: c1ccc(cc1)Oc1c2ccccc2cnn1

Synonyms:

• 1-Phenoxy-Phthalazin

1-Phenoxyphthalazine

CAS: 100537-30-2

Formula: C₁₄H₁₀N₂O

Color and Shape: Solid

Molecular weight: 222.242

Ref: IN-DA0002AI

1-Phenoxyphthalazine

CAS: 100537-30-2

1-Phenoxyphthalazine is a n-oxide with life-threatening properties. It is used as a medication for high blood pressure and as an anxiolytic. 1-Phenoxyphazin has been shown to have receptor affinity for the dopamine, serotonin, and noradrenaline receptors. It also blocks the carboxylate ion channels of the central nervous system. 1-Phenoxyphthalazine has been shown to have peroxide and chloride properties, which may contribute to its antihypertensive effects.

Formula: C₁₄H₁₀N₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 222.24 g/mol

Ref: 3D-FP26894