CymitQuimica logo

CAS 100540-61-2

:

6,8-DIIODO-4-QUINAZOLONE

Description:
6,8-Diiodo-4-quinazolone is a chemical compound characterized by its unique structure, which includes a quinazolone core substituted with iodine atoms at the 6 and 8 positions. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of iodine atoms can enhance its lipophilicity and influence its reactivity, making it of interest in medicinal chemistry and material science. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many halogenated compounds, 6,8-diiodo-4-quinazolone may have implications for environmental and health safety, necessitating careful handling and assessment in research and application contexts. Overall, this compound represents a significant area of study for researchers exploring its potential applications in pharmaceuticals and other fields.
Formula:C8H4I2N2O
InChI:InChI=1S/C8H4I2N2O/c9-4-1-5-7(6(10)2-4)11-3-12-8(5)13/h1-3H,(H,11,12,13)
InChI key:BKXIKKIMTDJQTM-UHFFFAOYSA-N
SMILES:C1=C(C=C(C2=C1C(=O)NC=N2)I)I
Found 1 products.