CymitQuimica logo

CAS 1005494-37-0

:

2-[[[4-Methoxy-3-[[(4-methylphenyl)sulfonyl]oxy]phenyl]methyl]sulfonyl]acetic acid

Description:
2-[[[4-Methoxy-3-[[(4-methylphenyl)sulfonyl]oxy]phenyl]methyl]sulfonyl]acetic acid, identified by its CAS number 1005494-37-0, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as sulfonyl, methoxy, and carboxylic acid. This compound typically exhibits properties associated with sulfonyl-containing molecules, including potential solubility in polar solvents and the ability to participate in various chemical reactions due to the presence of reactive functional groups. Its methoxy and sulfonyl moieties may contribute to its biological activity, making it of interest in pharmaceutical research. The compound's structure suggests it may have applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Additionally, the presence of aromatic rings in its structure may influence its stability and reactivity, as well as its interaction with biological systems. Overall, this compound represents a class of molecules that could have significant implications in drug design and development.
Formula:C17H18O8S2
InChI:InChI=1S/C17H18O8S2/c1-12-3-6-14(7-4-12)27(22,23)25-16-9-13(5-8-15(16)24-2)10-26(20,21)11-17(18)19/h3-9H,10-11H2,1-2H3,(H,18,19)
InChI key:InChIKey=FUGNUQSWIFVNFD-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=CC=C(C)C=C1)C2=C(OC)C=CC(CS(CC(O)=O)(=O)=O)=C2
Synonyms:
  • 2-[[[4-Methoxy-3-[[(4-methylphenyl)sulfonyl]oxy]phenyl]methyl]sulfonyl]acetic acid
  • 2-(4-Methoxy-3-(tosyloxy)benzylsulfonyl)acetic acid
  • Acetic acid, 2-[[[4-methoxy-3-[[(4-methylphenyl)sulfonyl]oxy]phenyl]methyl]sulfonyl]-
Found 1 products.