CymitQuimica logo

CAS 10057-27-9

:

Hexafluoroacetone

Description:
Hexafluoroacetone is a colorless, volatile liquid with a distinctive odor, classified as a fluorinated ketone. Its molecular formula is C3F6O, and it features a central carbonyl group (C=O) flanked by three fluorinated carbon atoms. This compound is notable for its high reactivity, particularly due to the presence of the electronegative fluorine atoms, which enhance its electrophilic character. Hexafluoroacetone is soluble in organic solvents but has limited solubility in water. It is used in various applications, including as a reagent in organic synthesis and as a precursor in the production of fluorinated compounds. Additionally, it has been studied for its potential use in the development of pharmaceuticals and agrochemicals. However, hexafluoroacetone is also recognized for its toxicity and potential environmental impact, necessitating careful handling and storage. Its chemical properties, such as its boiling point and vapor pressure, make it significant in industrial processes, particularly in the field of fluorochemistry.
Formula:C3F6O
InChI:InChI=1/C3F6O/c4-2(5,6)1(10)3(7,8)9
InChI key:AKVXSYUWYXOLMY-UHFFFAOYSA-N
SMILES:C(=O)(C(F)(F)F)C(F)(F)F
Synonyms:
  • 1,1,1,3,3,3-Hexafluoro-2-propanone
  • Hexafluoro-2-propanone
  • 1,1,1,3,3,3-Hexafluoropropan-2-One
Found 3 products.