CAS 100587-92-6: Acetic acid, terbium(3+) salt, hydrate
Description:Acetic acid, terbium(3+) salt, hydrate, with the CAS number 100587-92-6, is a coordination compound formed between terbium ions and acetic acid, typically existing in a hydrated form. Terbium is a rare earth element known for its luminescent properties, and when complexed with acetic acid, it can exhibit unique optical characteristics. This compound is generally characterized by its solubility in polar solvents, such as water, due to the presence of the acetate ligands. The hydrated form indicates the presence of water molecules in its crystal structure, which can influence its stability and reactivity. In terms of applications, terbium salts are often utilized in phosphors, lasers, and as dopants in various materials due to their ability to emit light when excited. The compound may also exhibit specific thermal and spectral properties, making it of interest in materials science and photonics. Safety considerations should be taken into account, as with all rare earth compounds, due to potential toxicity and environmental impact.
Formula:C2H4O2·xH2OTb
InChI:InChI=1S/C2H4O2.H2O.Tb/c1-2(3)4;;/h1H3,(H,3,4);1H2;
InChI key:InChIKey=AOPUKHFGCKRYIX-UHFFFAOYSA-N
SMILES:[Tb].O=C(O)C.O
- Synonyms:
- Acetate, Terbium(3+) Salt, Monohydrate
- Acetic acid, terbium(3+) salt, hydrate
- Terbium acetate, hydrate
- Terbium(3+) Triacetate
- Terbium(3+) Triacetate Hydrate
- Terbium(III) acetate hydrate
- Terbiumacetatehydrate
