CymitQuimica logo

CAS 10059-13-9

:

2-Methyl-2-undecanethiol

Description:
2-Methyl-2-undecanethiol, with the CAS number 10059-13-9, is an organic compound belonging to the class of thiols, characterized by the presence of a sulfhydryl (-SH) group. This compound features a long hydrocarbon chain, specifically consisting of eleven carbon atoms, with a methyl group attached to the second carbon. Its structure contributes to its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. 2-Methyl-2-undecanethiol is known for its strong, often unpleasant odor, which is typical of many thiols, and it is used in various applications, including as a flavoring agent and in the synthesis of other chemical compounds. The presence of the thiol group imparts unique reactivity, allowing it to participate in various chemical reactions, such as oxidation and substitution. Additionally, this compound may exhibit biological activity, making it of interest in both industrial and research contexts. Proper handling and storage are essential due to its potential volatility and odor.
Formula:C12H26S
InChI:InChI=1S/C12H26S/c1-4-5-6-7-8-9-10-11-12(2,3)13/h13H,4-11H2,1-3H3
InChI key:InChIKey=FRQQKWGDKVGLFI-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C(C)(C)S
Synonyms:
  • 2-Undecanethiol, 2-methyl-
  • 2-Methyl-2-undecanethiol
  • 1,1-Dimethyl-1-decanethiol
  • 1,1-Dimethyl-decyl-mercaptan
  • 2-Methylundecyl-2-thiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.