CymitQuimica logo

CAS 100594-13-6

:

4-iodo-6-methoxypyrimidin-2-amine

Description:
4-Iodo-6-methoxypyrimidin-2-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of an iodine atom at the 4-position and a methoxy group at the 6-position contributes to its unique reactivity and properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino and methoxy functional groups, which can engage in hydrogen bonding. It may also display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. The compound's molecular structure allows for potential interactions with various biological targets, and its halogen substitution can influence its electronic properties and reactivity. As with many pyrimidine derivatives, it may participate in nucleophilic substitution reactions, and its iodine atom can serve as a leaving group in synthetic applications. Overall, 4-iodo-6-methoxypyrimidin-2-amine is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C5H6IN3O
InChI:InChI=1/C5H6IN3O/c1-10-4-2-3(6)8-5(7)9-4/h2H,1H3,(H2,7,8,9)
InChI key:OUUIKPWOPKWOHG-UHFFFAOYSA-N
SMILES:COc1cc(I)[nH]c(=N)n1
Synonyms:
  • 2-Pyrimidinamine, 4-iodo-6-methoxy-
Found 4 products.