CymitQuimica logo

CAS 100599-62-0

:

2-chloro-N-(3-fluoro-4-methylphenyl)acetamide

Description:
2-Chloro-N-(3-fluoro-4-methylphenyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent at the second position of the acetamide, and a 3-fluoro-4-methylphenyl group attached to the nitrogen atom of the amide. The presence of the chlorine and fluorine atoms contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and agrochemical applications. The molecular structure indicates that it may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of these halogen substituents. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose environmental and health risks. Overall, 2-chloro-N-(3-fluoro-4-methylphenyl)acetamide represents a class of compounds that may have significant applications in various fields of chemistry and biology.
Formula:C9H9ClFNO
InChI:InChI=1/C9H9ClFNO/c1-6-2-3-7(4-8(6)11)12-9(13)5-10/h2-4H,5H2,1H3,(H,12,13)
InChI key:KMMODUZPTOWVLF-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1F)N=C(CCl)O
Synonyms:
  • acetamide, 2-chloro-N-(3-fluoro-4-methylphenyl)-
  • 2-Chloro-N-(3-fluoro-4-methylphenyl)acetamide
Found 3 products.