CAS 1006-21-9
:Furo[3,4-c]pyridin-7-ol, 1,3-dihydro-6-methyl-, hydrochloride (1:1)
Description:
Furo[3,4-c]pyridin-7-ol, 1,3-dihydro-6-methyl-, hydrochloride (1:1), with CAS number 1006-21-9, is a chemical compound characterized by its fused ring structure that incorporates both furan and pyridine moieties. This compound typically exhibits a pale yellow to white crystalline appearance and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the hydroxyl group contributes to its potential as a weak acid, while the methyl group can influence its lipophilicity and biological activity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, which may include effects on the central nervous system or other biological pathways. Its synthesis and characterization often involve standard organic chemistry techniques, and it may be used as a building block in the development of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H9NO2·ClH
InChI:InChI=1S/C8H9NO2.ClH/c1-5-8(10)7-4-11-3-6(7)2-9-5;/h2,10H,3-4H2,1H3;1H
InChI key:InChIKey=RTYSWYUCXGLWNW-UHFFFAOYSA-N
SMILES:OC1=C2C(=CN=C1C)COC2.Cl
Synonyms:- 6-Methyl-1,3-Dihydrofuro[3,4-C]Pyridin-7-Ol Hydrochloride
- Furo[3,4-c]pyridin-7-ol, 1,3-dihydro-6-methyl-, hydrochloride
- Furo[3,4-c]pyridin-7-ol, 1,3-dihydro-6-methyl-, hydrochloride (1:1)
- 1,3-Dihydro-6-methylfuro[3,4-c]pyridin-7-ol hydrochloride
- 1,3-Dihydro-6-methylfuro(3,4-c)pyridin-7-ol hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Furo[3,4-c]pyridin-7-ol, 1,3-dihydro-6-methyl-, hydrochloride (1:1)
CAS:Furo[3,4-c]pyridin-7-ol, 1,3-dihydro-6-methyl-, hydrochloride (1:1)Formula:C8H10ClNO2Purity:95%Molecular weight:187.62Pyridoxine Impurity A
CAS:6-Methyl-1,3-dihydrofuro[3,4-c]pyridin-7-ol hydrochlorideFormula:C8H10ClNO2Purity:95%Molecular weight:187.62Pyridoxine EP Impurity A HCl
CAS:Formula:C8H9NO2·HClColor and Shape:Pale Yellow SolidMolecular weight:151.17 36.46Pyridoxine EP Impurity A as Hydrochloride
CAS:Controlled ProductFormula:C8H9NO2·ClHColor and Shape:NeatMolecular weight:187.62Pyridoxine Cyclic Ether Impurity Hydrochloride Salt
CAS:Controlled ProductStability Unstable in aqueous solution
Applications Pyridoxine (P991735) analog. Pyridoxine impurity.
References Geiger, R.E., et al.: Helv. Chimica Acta, 67, 1274 (1984),Formula:C8H9NO2·ClHColor and Shape:NeatMolecular weight:187.626-Methyl-1,3-dihydrofuro[3,4-c]pyridin-7-ol hydrochloride
CAS:Formula:C8H10ClNO2Purity:95%Molecular weight:187.62Pyridoxine Cyclic Ether Impurity Hydrochloride Salt
CAS:Versatile small molecule scaffoldFormula:C8H10ClNO2Purity:Min. 95%Molecular weight:187.61 g/mol









