CAS 1006-23-1
:5-Nitroso-2,4,6-pyrimidinetriamine
Description:
5-Nitroso-2,4,6-pyrimidinetriamine, with the CAS number 1006-23-1, is a chemical compound that belongs to the class of pyrimidine derivatives. It features a pyrimidine ring substituted with a nitroso group and three amino groups, which contribute to its unique reactivity and properties. This compound is typically characterized by its solid state at room temperature and may exhibit a range of colors depending on its specific form and purity. The presence of the nitroso group imparts potential for redox reactions, while the amino groups can participate in hydrogen bonding and nucleophilic reactions. 5-Nitroso-2,4,6-pyrimidinetriamine is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a precursor for synthesizing other nitrogen-containing compounds. However, handling this compound requires caution, as it may pose health risks, and appropriate safety measures should be observed.
Formula:C4H6N6O
InChI:InChI=1S/C4H6N6O/c5-2-1(10-11)3(6)9-4(7)8-2/h(H6,5,6,7,8,9)
InChI key:InChIKey=XLQQJSWJHHKLOK-UHFFFAOYSA-N
SMILES:N(=O)C=1C(N)=NC(N)=NC1N
Synonyms:- 2,4,6-Pyrimidinetriamine, 5-nitroso-
- 2,4,6-Triamino-5-nitrosopyrimidine
- 5-Nitropyrimidine-2,4,6-Triamine
- 5-Nitroso-2,4,6-pyrimidinetriamine
- 5-Nitrosopyrimidine-2,4,6-Triamine
- NSC 67309
- NSC 677554
- Pyrimidine, 2,4,6-triamino-5-nitroso-
- Tx 1041
- 5-Nitroso-2,4,6-triaminopyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
2,4,6-Triamino-5-nitrosopyrimidine
CAS:Formula:C4H6N6OPurity:>98.0%(T)(HPLC)Color and Shape:Light red to Red powder to crystalMolecular weight:154.13NITROSOTRIAMINOPYRIMIDINE CRS
CAS:NITROSOTRIAMINOPYRIMIDINE CRSFormula:C4H6N6OMolecular weight:154.13Triamterene Related Compound A (2,4,6-triamino-5-nitrosopyrimidine)
CAS:Compounds containing a pyrimidine ring (whether or notFormula:C4H6N6OColor and Shape:Red Pink Crystalline PowderMolecular weight:154.060312,4,6-Pyrimidinetriamine, 5-nitroso-
CAS:Formula:C4H6N6OPurity:97%Color and Shape:SolidMolecular weight:154.13002,4,6-Triamino-5-Nitrosopyrimidine
CAS:2,4,6-Triamino-5-NitrosopyrimidineFormula:C4H6N6OPurity:97%Molecular weight:154.135-Nitroso-2,4,6-triaminopyrimidine
CAS:Formula:C4H6N6OColor and Shape:Light red to red crystalline powderMolecular weight:154.135-Nitrosopyrimidine-2,4,6-triamine (Nitrosotriaminopyrimidine)
CAS:Controlled ProductFormula:C4H6N6OColor and Shape:NeatMolecular weight:154.135-Nitroso-2,4,6-triaminopyrimidine
CAS:5-Nitroso-2,4,6-triaminopyrimidine is a chemical compound that has been shown to have anticancer activity. It reacts with nucleophilic compounds such as hydroxides of metals and amides to form an amide bond. 5-Nitroso-2,4,6-triaminopyrimidine inhibits the enzyme glycosylase by reacting with it in a nucleophilic attack. This reaction leads to the formation of a stable nitrosamine intermediate that can be hydrolyzed by an acid or base. The inhibitory effect of 5-Nitroso-2,4,6-triaminopyrimidine on malonic acid decarboxylase (MAD) and anthranilic acid synthase (AAS) in animals is due to its ability to react with these enzymes in a similar way as for MAD and AAS in humans. Inhibition of MAD and AAS leads to reduced levels of malonicFormula:C4H6N6OPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:154.13 g/mol5-Nitroso-2,4,6-triaminopyrimidine
CAS:Controlled ProductFormula:C4H6N6OColor and Shape:NeatMolecular weight:154.13












