CymitQuimica logo

CAS 1006319-26-1

:

4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid

Description:
4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a trifluoromethyl group. This compound features an acetic acid functional group, contributing to its acidic properties. The presence of the bromine and trifluoromethyl groups enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical research. The trifluoromethyl group is known for imparting lipophilicity and can affect the compound's solubility and permeability. Additionally, the pyrazole moiety is often associated with various biological activities, including anti-inflammatory and analgesic effects. The compound's molecular structure allows for potential applications in medicinal chemistry, agrochemicals, or as a building block in organic synthesis. Its CAS number, 1006319-26-1, provides a unique identifier for regulatory and safety information. Overall, this compound exemplifies the intersection of halogenated compounds and heterocycles in modern chemical research.
Formula:C6H4BrF3N2O2
InChI:InChI=1S/C6H4BrF3N2O2/c7-3-1-12(2-4(13)14)11-5(3)6(8,9)10/h1H,2H2,(H,13,14)
InChI key:InChIKey=QQMGWXGYXKPKSH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=NN(CC(O)=O)C=C1Br
Synonyms:
  • 4-Bromo-3-(trifluoromethyl)-1H-pyrazole-1-acetic acid
  • 1H-Pyrazole-1-acetic acid, 4-bromo-3-(trifluoromethyl)-
Found 3 products.