CymitQuimica logo

CAS 1006319-31-8

:

4-Chloro-1H-pyrazole-1-butanoic acid

Description:
4-Chloro-1H-pyrazole-1-butanoic acid is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. The presence of a chloro group at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. The butanoic acid moiety indicates that this compound has a carboxylic acid functional group, which imparts acidic properties and can participate in various chemical transformations, such as esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical research and agrochemical applications. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many pyrazole derivatives, it may also be involved in coordination chemistry, forming complexes with metal ions. Overall, 4-Chloro-1H-pyrazole-1-butanoic acid is a versatile compound with potential utility in both synthetic and applied chemistry contexts.
Formula:C7H9ClN2O2
InChI:InChI=1S/C7H9ClN2O2/c8-6-4-9-10(5-6)3-1-2-7(11)12/h4-5H,1-3H2,(H,11,12)
InChI key:InChIKey=IXCJOGWPVAVMMT-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)N1N=CC(Cl)=C1
Synonyms:
  • 4-Chloro-1H-pyrazole-1-butanoic acid
  • 1H-Pyrazole-1-butanoic acid, 4-chloro-
Found 1 products.