CAS 100643-27-4
:2,6-Diamino-4-pyrimidinol
Description:
2,6-Diamino-4-pyrimidinol is an organic compound characterized by its pyrimidine ring structure, which features two amino groups at the 2 and 6 positions and a hydroxymethyl group at the 4 position. This compound is typically a white to off-white crystalline solid and is soluble in water due to the presence of the amino and hydroxyl functional groups, which can engage in hydrogen bonding. It is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of multiple amino groups makes it a versatile building block in organic synthesis, allowing for further functionalization. Additionally, 2,6-Diamino-4-pyrimidinol may exhibit biological activity, which can be of interest in medicinal chemistry. Its stability and reactivity can vary depending on the pH and the presence of other chemical species in the environment. As with many chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C4H6N4O
InChI:InChI=1S/C4H6N4O/c5-2-1-3(9)8-4(6)7-2/h1H,(H5,5,6,7,8,9)
InChI key:InChIKey=SWELIMKTDYHAOY-UHFFFAOYSA-N
SMILES:NC=1C=C(O)N=C(N)N1
Synonyms:- 4-Pyrimidinol, 2,6-diamino-
- 2,6-Diamino-4-pyrimidinol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6-Diaminopyrimidin-4-ol
CAS:2,6-Diaminopyrimidin-4-olFormula:C4H6N4OPurity:97%Molecular weight:126.124-Pyrimidinol, 2,6-diamino-
CAS:Formula:C4H6N4OPurity:97%Color and Shape:SolidMolecular weight:126.11662,6-Diaminopyrimidin-4-ol
CAS:2,6-Diaminopyrimidin-4-ol is a fluorescent probe that binds to the hydroxyl group of camp levels and has been shown to have potent antitumor activity. It is one of the most effective inhibitors of tumor necrosis factor-α (TNF-α) and has been shown to be effective in animal models for myocardial infarct. 2,6-Diaminopyrimidin-4-ol has significant cytotoxicity and can induce apoptosis in breast cancer cells. This drug also increases the sensitivity of C-reactive protein (CRP) assays by reducing background interference due to free radicals. It is used as a fluorescence detector for proximal tubules and tubule cells in kidney biopsies.
Formula:C4H6N4OPurity:Min. 95%Molecular weight:126.12 g/mol



