CymitQuimica logo

CAS 1006434-01-0

:

1-Ethyl-1H-pyrazole-4-carbonitrile

Description:
1-Ethyl-1H-pyrazole-4-carbonitrile is a heterocyclic organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of the ethyl group at the 1-position and a cyano group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential reactivity due to the presence of the cyano group, which can participate in nucleophilic reactions. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. The CAS number 1006434-01-0 uniquely identifies this substance in chemical databases, facilitating its study and application in various fields, including medicinal chemistry and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H7N3
InChI:InChI=1S/C6H7N3/c1-2-9-5-6(3-7)4-8-9/h4-5H,2H2,1H3
InChI key:SCVYEGXBMMZIET-UHFFFAOYSA-N
SMILES:CCN1C=C(C=N1)C#N
Found 4 products.