CymitQuimica logo

CAS 1006441-05-9

:

1-Methyl-3-[[[(1-methyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-1H-pyrazole-4-carboxylic acid

Description:
1-Methyl-3-[[[(1-methyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes multiple functional groups such as carboxylic acid and amine functionalities. This compound features a pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms, contributing to its potential biological activity. The presence of the methyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The compound's specific arrangement of substituents may impart unique pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions can be studied through various analytical techniques, including NMR and mass spectrometry, to elucidate its behavior in different environments. Additionally, the compound's CAS number, 1006441-05-9, allows for precise identification in chemical databases, facilitating research and development in fields such as drug discovery and agrochemicals. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function.
Formula:C11H13N5O3
InChI:InChI=1S/C11H13N5O3/c1-15-5-7(4-13-15)3-12-10(17)9-8(11(18)19)6-16(2)14-9/h4-6H,3H2,1-2H3,(H,12,17)(H,18,19)
InChI key:InChIKey=GMFJDSQPIALAES-UHFFFAOYSA-N
SMILES:C(NCC=1C=NN(C)C1)(=O)C=2C(C(O)=O)=CN(C)N2
Synonyms:
  • 1-Methyl-3-[[[(1-methyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-1H-pyrazole-4-carboxylic acid
  • 1H-Pyrazole-4-carboxylic acid, 1-methyl-3-[[[(1-methyl-1H-pyrazol-4-yl)methyl]amino]carbonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.