CymitQuimica logo

CAS 1006470-52-5

:

4-[(1-Methyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid

Description:
4-[(1-Methyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid, identified by its CAS number 1006470-52-5, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both organic acids and heterocyclic compounds. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group. The pyrazole moiety may contribute to its biological activity, potentially making it of interest in pharmaceutical research. The compound's reactivity can be influenced by the amino and carbonyl groups, allowing for various chemical transformations. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Overall, this compound represents a blend of organic chemistry and potential biological significance, warranting further investigation into its properties and applications.
Formula:C8H11N3O3
InChI:InChI=1S/C8H11N3O3/c1-11-5-6(4-9-11)10-7(12)2-3-8(13)14/h4-5H,2-3H2,1H3,(H,10,12)(H,13,14)
InChI key:InChIKey=NFNRLQULWIMBHD-UHFFFAOYSA-N
SMILES:N(C(CCC(O)=O)=O)C1=CN(C)N=C1
Synonyms:
  • 4-[(1-Methyl-1H-pyrazol-4-yl)amino]-4-oxobutanoic acid
  • Butanoic acid, 4-[(1-methyl-1H-pyrazol-4-yl)amino]-4-oxo-
Found 1 products.