CymitQuimica logo

CAS 1006592-47-7

:

Xanthylium, 3,6-diamino-9-[2-carboxy-4-[(2-propyn-1-ylamino)carbonyl]phenyl]-4,5-disulfo-, inner salt

Description:
Xanthylium, 3,6-diamino-9-[2-carboxy-4-[(2-propyn-1-ylamino)carbonyl]phenyl]-4,5-disulfo-, inner salt, identified by CAS number 1006592-47-7, is a synthetic organic compound characterized by its complex structure, which includes a xanthylium core, multiple amino groups, and sulfonic acid functionalities. This compound exhibits strong solubility in polar solvents due to its ionic and polar groups, making it suitable for various applications in biochemical and analytical chemistry. The presence of amino and carboxylic acid groups suggests potential for forming hydrogen bonds, enhancing its reactivity and interaction with biological molecules. Additionally, the sulfonic acid groups contribute to its acidic properties, which can influence its behavior in different pH environments. The compound's unique structure may also impart specific optical properties, making it useful in dye applications or as a fluorescent marker. Overall, its multifunctional nature allows for diverse applications in research and industry, particularly in fields involving biochemistry and materials science.
Formula:C24H17N3O10S2
InChI:InChI=1S/C24H17N3O10S2/c1-2-9-27-23(28)11-3-4-12(15(10-11)24(29)30)18-13-5-7-16(25)21(38(31,32)33)19(13)37-20-14(18)6-8-17(26)22(20)39(34,35)36/h1,3-8,10H,9,25-26H2,(H3-,27,28,29,30,31,32,33,34,35,36)
InChI key:InChIKey=YEGKYXFXUCSDTO-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=2C3=C(C(S(=O)(=O)[O-])=C(N)C=C3)[O+]=C4C2C=CC(N)=C4S(=O)(=O)O)C=CC(C(NCC#C)=O)=C1
Synonyms:
  • Alexa Fluor 488 alkyne
  • Xanthylium, 3,6-diamino-9-[2-carboxy-4-[(2-propyn-1-ylamino)carbonyl]phenyl]-4,5-disulfo-, inner salt
Found 2 products.