CymitQuimica logo

CAS 1006614-49-8

:

(1R trans)-2-(3,4-difluorophenyl)cyclopropane amine.HCl

Description:
(1R trans)-2-(3,4-difluorophenyl)cyclopropane amine hydrochloride, identified by the CAS number 1006614-49-8, is a chemical compound characterized by its cyclopropane structure substituted with a difluorophenyl group and an amine functional group. This compound typically exists as a hydrochloride salt, which enhances its solubility in water and makes it more suitable for pharmaceutical applications. The presence of the difluorophenyl moiety suggests potential biological activity, as fluorinated compounds often exhibit altered pharmacokinetic properties and increased metabolic stability. The trans configuration indicates specific stereochemistry, which can significantly influence the compound's interaction with biological targets. As a hydrochloride salt, it is likely to be a white crystalline solid, and its properties may include moderate to high melting points and stability under standard laboratory conditions. The compound's unique structure and functional groups may contribute to its potential use in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C9H9F2N
InChI:InChI=1S/C9H9F2N/c10-7-2-1-5(3-8(7)11)6-4-9(6)12/h1-3,6,9H,4,12H2/t6-,9+/m0/s1
InChI key:QVUBIQNXHRPJKK-IMTBSYHQSA-N
SMILES:C1[C@H]([C@@H]1N)C2=CC(=C(C=C2)F)F
Synonyms:
  • (1R trans)-2-(3,4-difluorophenyl)cyclopropaneamine HCl
  • (1R,2S)-Rel-2-(3,4-Difluorophenyl)Cyclopropanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.