CymitQuimica logo

CAS 1006619-83-5

:

2-Amino-5-chloro-3-methylbenzamide

Description:
2-Amino-5-chloro-3-methylbenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a chloro group, and a methyl group. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. The chloro substituent introduces a halogen, which can influence the compound's reactivity and polarity. The methyl group contributes to the overall hydrophobic character of the molecule. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests that it could be involved in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the specific arrangement of substituents on the benzene ring can affect its electronic properties and steric hindrance, influencing its interactions with other molecules. Overall, 2-Amino-5-chloro-3-methylbenzamide is a compound of interest in both synthetic and medicinal chemistry due to its unique functional groups and potential applications.
Formula:C8H9ClN2O
InChI:InChI=1S/C8H9ClN2O/c1-4-2-5(9)3-6(7(4)10)8(11)12/h2-3H,10H2,1H3,(H2,11,12)
InChI key:InChIKey=GJPVEWHLNAWLNW-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(N)C(C)=CC(Cl)=C1
Synonyms:
  • Benzamide, 2-amino-5-chloro-3-methyl-
  • 2-Amino-5-chloro-3-methylbenzamide
Found 3 products.