CAS 100665-40-5
:ganoderenic acid A
Description:
Ganoderenic acid A is a triterpenoid compound primarily derived from the Ganoderma lucidum, commonly known as reishi mushroom. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Ganoderenic acid A exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. Its mechanism of action often involves modulation of signaling pathways and inhibition of certain enzymes, which can lead to therapeutic benefits. Additionally, ganoderenic acid A is soluble in organic solvents, which influences its extraction and formulation in pharmaceutical applications. The compound's safety profile and efficacy are subjects of ongoing research, particularly in the context of traditional medicine and modern therapeutic strategies. Overall, ganoderenic acid A represents a significant area of study within the field of natural products and their potential health benefits.
Formula:C30H42O7
InChI:InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21,23,32,35H,8-9,11-14H2,1-7H3,(H,36,37)
InChI key:InChIKey=OVUOUFPIPZJGME-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3O)C(C)(C)C(=O)CC4)C(=O)CC1(C)C(C(=CC(CC(C(O)=O)C)=O)C)CC2O
Synonyms:- (5xi,7beta,15alpha,20E)-7,15-dihydroxy-3,11,23-trioxolanosta-8,20(22)-dien-26-oic acid
- (7β,15α,20E)-7,15-Dihydroxy-3,11,23-trioxolanosta-8,20(22)-dien-26-oic acid
- Lanosta-8,20(22)-dien-26-oic acid, 7,15-dihydroxy-3,11,23-trioxo-, (7beta,15alpha,20E)-
- Lanosta-8,20(22)-dien-26-oic acid, 7,15-dihydroxy-3,11,23-trioxo-, (7β,15α,20E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ganoderenic acid A
CAS:Ganoderenic acid A, is isolated as the potent inhibitor of beta-glucuronidase, it has a potent hepatoprotective effect against CCl4-induced liver injury.Formula:C30H42O7Purity:95%~99%Color and Shape:PowderMolecular weight:514.659Ganoderenic acid A
CAS:Ganoderenic acid A has a potent hepatoprotective, and cytotoxic effects, it shows inhibitory activity on human aldose reductase in vitro.Formula:C30H42O7Purity:97.27% - 98.50%Color and Shape:SolidMolecular weight:514.65Ganoderenic acid A
CAS:Controlled ProductGanoderenic acid A is a triterpenoid compound, which is a secondary metabolite sourced from the Ganoderma lucidum mushroom, commonly known as reishi. This compound exerts its effects through its anti-inflammatory and antioxidant activities, primarily by modulating various biochemical pathways, such as the inhibition of prostaglandin production and the scavenging of free radicals.Formula:C30H42O7Purity:Min. 95%Molecular weight:514.66 g/mol





