CAS 100665-42-7
:(3β,7β,15α,20E)-3,7,15-Trihydroxy-11,23-dioxolanosta-8,20(22)-dien-26-oic acid
Description:
The chemical substance known as (3β,7β,15α,20E)-3,7,15-Trihydroxy-11,23-dioxolanosta-8,20(22)-dien-26-oic acid, with the CAS number 100665-42-7, is a complex organic compound characterized by its unique structural features, including multiple hydroxyl groups and a dioxolane ring. This compound belongs to the class of triterpenoids, which are known for their diverse biological activities. The presence of multiple hydroxyl groups contributes to its potential solubility in polar solvents and may enhance its reactivity in various chemical processes. The specific stereochemistry indicated by the β and α designations suggests that the compound has distinct spatial arrangements that can influence its biological interactions and pharmacological properties. Additionally, the presence of a conjugated diene system may impart unique optical and electronic properties, making it of interest in both medicinal chemistry and materials science. Overall, this compound's structural complexity and functional groups suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents.
Formula:C30H44O7
InChI:InChI=1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21-23,32,34-35H,8-9,11-14H2,1-7H3,(H,36,37)
InChI key:InChIKey=DIEUZIPSDUGWLD-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3O)C(C)(C)C(O)CC4)C(=O)CC1(C)C(C(=CC(CC(C(O)=O)C)=O)C)CC2O
Synonyms:- (3β,7β,15α,20E)-3,7,15-Trihydroxy-11,23-dioxolanosta-8,20(22)-dien-26-oic acid
- Ganoderenic acid c
- Ganoderenicacid c
- Lanosta-8,20(22)-dien-26-oic acid, 3,7,15-trihydroxy-11,23-dioxo-, (3β,7β,15α,20E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ganoderenic acid C
CAS:Ganoderenic acid C is a natural productFormula:C30H44O7Purity:98%Color and Shape:SolidMolecular weight:516.675Ganoderenic acid C
CAS:Controlled ProductGanoderenic acid C is a bioactive triterpenoid compound, which is derived from the medicinal mushroom Ganoderma lucidum, commonly known as Reishi. It serves as a key component of the secondary metabolites of this fungus, recognized for their therapeutic potential. The mode of action of Ganoderenic acid C involves modulating immune responses and exhibiting antioxidant properties. It achieves immunomodulation by interacting with various cellular pathways, influencing cytokine production and enhancing immune cell activity. This acid exhibits a high affinity for specific receptor sites, which may contribute to its ability to exert biological effects.Formula:C30H44O7Purity:Min. 95%Molecular weight:516.68 g/mol





