CAS 100665-43-8
:Ganoderenic acid d
Description:
Ganoderenic acid D, identified by its CAS number 100665-43-8, is a triterpenoid compound primarily derived from the Ganoderma lucidum, commonly known as reishi mushroom. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Ganoderenic acid D exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its solubility profile suggests that it is more soluble in organic solvents than in water, which is common for many triterpenoids. The compound's mechanism of action is believed to involve modulation of various signaling pathways, contributing to its therapeutic effects. Additionally, Ganoderenic acid D is often studied for its role in traditional medicine, particularly in East Asian cultures, where reishi mushrooms have been used for centuries to promote health and longevity. Overall, Ganoderenic acid D represents a significant area of interest in natural product chemistry and medicinal research.
Formula:C30H40O7
InChI:InChI=1S/C30H40O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21,32H,8-9,11-14H2,1-7H3,(H,36,37)
InChI key:InChIKey=JGWQYLZHPPFHEH-UHFFFAOYSA-N
SMILES:CC12C3=C(C4(C)C(CC3O)C(C)(C)C(=O)CC4)C(=O)CC1(C)C(C(=CC(CC(C(O)=O)C)=O)C)CC2=O
Synonyms:- (7β,20E)-7-Hydroxy-3,11,15,23-tetraoxolanosta-8,20(22)-dien-26-oic acid
- Ganoderenic acid d
- Ganoderenicacid d
- Lanosta-8,20(22)-dien-26-oic acid, 7-hydroxy-3,11,15,23-tetraoxo-, (7β,20E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ganoderenic acid D
CAS:Formula:C30H40O7Purity:95%~99%Color and Shape:White cryst.Molecular weight:512.643Ganoderenic acid D
CAS:Ganoderenic acid D, extracted from Ganoderma lucidum, triggers apoptosis and halts cancer cell growth.Formula:C30H40O7Purity:99.05%Color and Shape:SolidMolecular weight:512.63Ganoderenic acid D
CAS:Controlled ProductGanoderic acid D is a triterpenoid that exhibits cytotoxic properties against human cervical cancer cells. Ganoderic acid D has been shown to induce autophagy, a process in which the cell breaks down and recycles its own organelles for energy. This compound also induces apoptosis by inhibiting the synthesis of proteins. Ganoderic acid D has been shown to have significant cytotoxicity against human liver cancer cells, and it inhibits cholesterol synthesis by blocking the activity of key enzymes such as 3-hydroxy-3-methylglutaryl coenzyme A reductase (HMGCR) and squalene synthase. Ganoderic acid D also blocks the production of prostaglandin E2 (PGE2) by inhibiting cyclooxygenase-2 (COX-2). Other studies have also demonstrated that this compound has anti-inflammatory effects when combined with adjuvant therapies.Purity:Min. 95%





