CymitQuimica logo

CAS 100683-08-7

:

Cyclopropanecarboxylic acid, 1-methoxy-

Description:
Cyclopropanecarboxylic acid, 1-methoxy- is an organic compound characterized by its cyclopropane ring structure, which is a three-membered carbon ring. This compound features a carboxylic acid functional group (-COOH) and a methoxy group (-OCH3) attached to the cyclopropane ring. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis. Cyclopropanecarboxylic acid derivatives are often studied for their interesting chemical properties, including their ability to undergo various reactions such as esterification and decarboxylation. The methoxy group can influence the compound's polarity and solubility, affecting its behavior in different solvents. Additionally, the unique strain of the cyclopropane ring can lead to distinctive reactivity patterns compared to more stable ring structures. Overall, this compound is of interest in both academic research and potential industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C5H8O3
InChI:InChI=1S/C5H8O3/c1-8-5(2-3-5)4(6)7/h2-3H2,1H3,(H,6,7)
InChI key:HPOWDCXQUZLJRQ-UHFFFAOYSA-N
SMILES:COC1(CC1)C(=O)O
Found 6 products.