
CAS 100684-32-0
:Myoglobins, horse
Description:
Myoglobin is a heme-containing protein primarily found in muscle tissues, where it serves as an oxygen storage and transport molecule. In horses, myoglobin plays a crucial role in facilitating oxygen delivery to muscle cells during periods of intense physical activity. The specific myoglobin from horses, identified by the CAS number 100684-32-0, exhibits characteristics typical of myoglobins, including a globular structure and the ability to bind oxygen reversibly. This protein contains a heme group, which is responsible for its red color and oxygen-binding capacity. Myoglobin's affinity for oxygen can vary based on factors such as pH and the presence of carbon dioxide, which are critical for efficient oxygen release during muscle contraction. Additionally, horse myoglobin is known for its relatively high oxygen-binding affinity compared to other species, reflecting the horse's evolutionary adaptations for endurance and performance. Overall, myoglobin is essential for maintaining aerobic metabolism in muscle tissues, particularly in animals that engage in sustained physical exertion.
Formula:Unspecified
InChI:InChI=1S/C14H23NO.C6H3N3O7/c1-10-7-8-13(14(3,4)16)12(11(10)2)9-15(5)6;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h7-8,16H,9H2,1-6H3;1-2,10H
InChI key:RHENBVYWBWUEFP-UHFFFAOYSA-N
SMILES:CC1=C(C(=C(C=C1)C(C)(C)O)CN(C)C)C.C1=C(C=C(C(=C1[N+](=O)[O-])O)[N+](=O)[O-])[N+](=O)[O-]
Synonyms:- Myoglobins, horse
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Myoglobin from equine skeletal muscle
CAS:Controlled ProductMyoglobin is a protein that is found in the muscle cells of vertebrates. It is a large, iron- and oxygen-binding protein molecule with a molecular weight of 17,000 Da. Myoglobin has been shown to have an inhibitory effect on the growth of colorectal adenocarcinoma cells. The anticancer activity of myoglobin may be due to its ability to bind to and inhibit the proliferation of cancer cells by binding to DNA and inhibiting transcription. In addition, myoglobin also has antimicrobial properties that are attributed to its ability to bind bacterial cell wall lipopolysaccharides (LPS) and prevent their interaction with host tissues, thereby preventing inflammation.Purity:Min. 95%Ref: 3D-AEA68432
Discontinued product


