CymitQuimica logo

CAS 1006865-32-2

:

Benzene,1-bromo-4-[[(2S)-3-methoxy-2-methylpropoxy]methyl]-

Description:
Benzene, 1-bromo-4-[[(2S)-3-methoxy-2-methylpropoxy]methyl]- is an organic compound characterized by its complex structure, which includes a bromobenzene moiety and a methoxy-substituted alkyl chain. The presence of the bromine atom at the para position of the benzene ring contributes to its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. The methoxy group enhances the compound's solubility in organic solvents and may influence its biological activity. The stereochemistry indicated by the (2S) designation suggests that the compound has a specific three-dimensional arrangement, which can affect its interactions with biological systems. This compound may be of interest in medicinal chemistry and material science due to its unique structural features. Additionally, its properties, such as boiling point, melting point, and solubility, would be influenced by the functional groups present and the overall molecular structure. Safety and handling precautions should be observed, as brominated compounds can pose health risks.
Formula:C12H17BrO2
InChI:InChI=1S/C12H17BrO2/c1-10(7-14-2)8-15-9-11-3-5-12(13)6-4-11/h3-6,10H,7-9H2,1-2H3/t10-/m0/s1
InChI key:RWPUBXVEDLEIPS-JTQLQIEISA-N
SMILES:C[C@@H](COC)COCC1=CC=C(C=C1)Br
Synonyms:
  • (S)-1-Bromo-4-((3-methoxy-2-methylpropoxy)methyl)benzene
  • 1-Bromo-4-[[((S)-3-methoxy-2-methylpropyl)oxy]methyl]benzene
  • benzene, 1-bromo-4-[[[(2S)-3-methoxy-2-methylpropyl]oxy]methyl]-
Found 1 products.