CAS 1007-16-5
:3-Bromo-4-fluorobenzoic acid
Description:
3-Bromo-4-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and fluorine substituents on the benzene ring. Specifically, the bromine atom is located at the meta position (3-position) and the fluorine atom at the para position (4-position) relative to the carboxylic acid group (-COOH). This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents and limited solubility in water, which is common for halogenated benzoic acids. The presence of the halogens can influence its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting properties such as varying acidity and potential for hydrogen bonding due to the carboxylic acid functional group. Its unique structure allows for specific interactions in biological systems, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as with many halogenated organic substances.
Formula:C7H4BrFO2
InChI:InChI=1S/C7H4BrFO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11)
InChI key:InChIKey=ONELILMJNOWXSA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Br)=C(F)C=C1
Synonyms:- 3-Bromo-4-Fiuorobenzoic Acid
- 3-Bromo-4-Fluorobenzoate
- 3-Bromo-4-fluorobenzoic acid 98%
- 3-Bromo-4-fluorobenzoicacid98%
- Benzoic acid, 3-bromo-4-fluoro-
- Buttpark 20\01-58
- Rarechem Al Bo 0604
- 3-Bromo-4-fluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-Bromo-4-fluorobenzoic Acid
CAS:Formula:C7H4BrFO2Purity:>96.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:219.013-Bromo-4-fluorobenzoic acid, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H3BrFO2Purity:96%Color and Shape:Powder, Pale creamMolecular weight:218.00Benzoic acid, 3-bromo-4-fluoro-
CAS:Formula:C7H4BrFO2Purity:97%Color and Shape:SolidMolecular weight:219.00793-Bromo-4-fluorobenzoic acid
CAS:3-Bromo-4-fluorobenzoic acidFormula:C7H4BrFO2Purity:98%Color and Shape:SolidMolecular weight:219.007863-Bromo-4-fluorobenzoic acid
CAS:Formula:C7H4BrFO2Purity:98%Color and Shape:FibersMolecular weight:219.009






