CAS 1007-99-4
:2-AMINO-4-CHLORO-6-HYDROXY-5-NITROPYRIMIDINE
Description:
2-Amino-4-chloro-6-hydroxy-5-nitropyrimidine, with the CAS number 1007-99-4, is a heterocyclic organic compound that belongs to the pyrimidine family. This compound features a pyrimidine ring substituted with an amino group, a chloro group, a hydroxy group, and a nitro group, which contribute to its unique chemical properties. It is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the presence of the hydroxy group. The presence of multiple functional groups makes it a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its nitro group can participate in various chemical reactions, including reduction and substitution, while the amino and hydroxy groups can engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is of interest in both research and industrial applications due to its diverse functional characteristics.
Formula:C4H3ClN4O3
InChI:InChI=1/C4H3ClN4O3/c5-2-1(9(11)12)3(10)8-4(6)7-2/h1H,(H2,6,8,10)
SMILES:C1(C(=NC(=N)N=C1O)Cl)N(=O)=O
Synonyms:- Achnp
- Akos 92816
- 2-Amino-4-Chloro-5-Nitro-6-Hydroxypyrimidine
- 2-Amino-6-chloro-5-nitropyrimidin-4-ol
- 2-Amino-6-chloro-5-nitropyrimidin-4(5H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-chloro-6-hydroxy-5-nitropyrimidine
CAS:2-Amino-4-chloro-6-hydroxy-5-nitropyrimidineFormula:C4H3ClN4O3Purity:90%Color and Shape:SolidMolecular weight:190.544622-Amino-4-chloro-6-hydroxy-5-nitropyrimidine
CAS:Formula:C4H3ClN4O3Purity:90%Color and Shape:SolidMolecular weight:190.54462-Amino-4-chloro-6-hydroxy-5-nitropyrimidine
CAS:2-Amino-4-chloro-6-hydroxy-5-nitropyrimidineFormula:C4H3ClN4O3Purity:90%Molecular weight:190.542-Amino-4-chloro-6-hydroxy-5-nitropyrimidine
CAS:Formula:C4H3ClN4O3Purity:95.0%Color and Shape:SolidMolecular weight:190.542-Amino-4-chloro-5-nitro-6-hydroxypyrimidine
CAS:2-Amino-4-chloro-5-nitro-6-hydroxypyrimidine is an alkylating agent that is synthesized by the reaction of phenacylamine with a diazonium salt in the presence of an alkali metal. It can be used for the synthesis of sulfoxides and sulfones. 2-Amino-4-chloro-5-nitro-6-hydroxypyrimidine has been used to treat immunodeficiency, but its antiviral activity has not been investigated. It is a chiral molecule and can be synthesized from lysine, guanine, and norvaline through a two step process that involves the formation of a sulfoxide intermediate followed by nitration. This drug also inhibits dihydropteridine reductase, which produces tetrahydrobiopterin (BH4), an essential cofactor for the synthesis of neurotransmitters such as serotoninFormula:C4H3ClN4O3Purity:(%) Min. 95%Color and Shape:PowderMolecular weight:190.54 g/mol




