CymitQuimica logo

CAS 100708-30-3

:

[1-(3-aminopropyl)piperidin-3-yl]methanol

Description:
[1-(3-aminopropyl)piperidin-3-yl]methanol, with the CAS number 100708-30-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features an amino group attached to a propyl chain, contributing to its potential as a bioactive molecule. The presence of the hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting the central nervous system. Its structural features suggest potential interactions with neurotransmitter systems, although specific biological activities would require empirical investigation. Additionally, the compound's stability, reactivity, and potential toxicity would need to be assessed in the context of its intended applications. Overall, [1-(3-aminopropyl)piperidin-3-yl]methanol represents a versatile scaffold for further chemical modifications and research in therapeutic contexts.
Formula:C9H20N2O
InChI:InChI=1/C9H20N2O/c10-4-2-6-11-5-1-3-9(7-11)8-12/h9,12H,1-8,10H2
InChI key:LEGYMQGRRTXEDZ-UHFFFAOYSA-N
SMILES:C1CC(CN(C1)CCCN)CO
Found 4 products.