CAS 1007089-84-0
:3-(Chloromethyl)-5-methylpyridine hydrochloride
Description:
3-(Chloromethyl)-5-methylpyridine hydrochloride is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloromethyl group (-CH2Cl) and a methyl group (-CH3) attached to the pyridine ring, contributing to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically encountered in a crystalline form and is soluble in water, which enhances its utility in various chemical reactions. The presence of the chloromethyl group makes it a valuable intermediate in the synthesis of other organic compounds, particularly in the pharmaceutical and agrochemical industries. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety precautions should be observed when handling this compound, as it may pose health risks due to the presence of chlorine and its potential reactivity.
Formula:C7H8ClN
InChI:InChI=1S/C7H8ClN.ClH/c1-6-2-7(3-8)5-9-4-6;/h2,4-5H,3H2,1H3;1H
InChI key:NCAHREJYXFDWGE-UHFFFAOYSA-N
SMILES:CC1=CC(=CN=C1)CCl.Cl
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-(Chloromethyl)-5-methylpyridine hydrochloride
CAS:Formula:C7H9Cl2NPurity:97%Color and Shape:SolidMolecular weight:178.063-(Chloromethyl)-5-methylpyridine hydrochloride
CAS:Formula:C7H9Cl2NPurity:97%Color and Shape:SolidMolecular weight:178.05913-(Chloromethyl)-5-methylpyridine hydrochloride
CAS:3-(Chloromethyl)-5-methylpyridine hydrochlorideFormula:C7H8ClN·ClHPurity:>98%Color and Shape:Solid-PowderMolecular weight:178.05906Rupatadine Impurity 6 HCl
CAS:Formula:C7H8ClN·HClColor and Shape:White To Off-White SolidMolecular weight:141.60 36.463-(Chloromethyl)-5-methylpyridine hydrochloride
CAS:3-(Chloromethyl)-5-methylpyridine hydrochlorideFormula:C7H9Cl2NPurity:97%Molecular weight:178.063-Chloromethyl-5-methylpyridine Hydrochloride
CAS:Controlled ProductApplications 3-Chloromethyl-5-methylpyridine is an intermediate in the synthesis of Rupatadine (R701650).
References Merlos, M., et al.: Pharmacol. Exp. Therap., 280, 114 (1997), Bell, I., et al.: J. Med. Chem., 41, 2146 (1998),Formula:C7H8ClN·ClHColor and Shape:NeatMolecular weight:178.063-(Chloromethyl)-5-methylpyridine hydrochloride
CAS:3-(Chloromethyl)-5-methylpyridine hydrochloride (3CMPH) is a chemical compound that is synthesized from chlorine and methylpyridine. 3CMPH can be produced by the reaction of chlorination with toluene or hydrogen chloride. The synthesis of 3CMPH is done in two steps: first, reacting toluene with chlorine gas at high temperature and pressure in the presence of sulfuric acid, followed by the addition of sulfuric acid to the resulting product. In the second step, hydrogen chloride reacts with methylpyridine in an alkaline solution, yielding 3-(chloromethyl)-5-methylpyridine hydrochloride as a white solid. 3CMPH has been shown to have antihistamine effects and can be used for treating allergies. It can also be used as a skin protectant against uv light and rupatadine.Formula:C7H8ClN·HClPurity:Min. 95%Molecular weight:178.06 g/mol







