CymitQuimica logo

CAS 10071-07-5

:

N,N,2-trimethyl-3-(5-oxido-10H-phenothiazin-10-yl)propan-1-amine

Description:
N,N,2-trimethyl-3-(5-oxido-10H-phenothiazin-10-yl)propan-1-amine, with CAS number 10071-07-5, is a chemical compound characterized by its complex structure, which includes a phenothiazine moiety. This compound features a propan-1-amine backbone that is substituted with three methyl groups and a phenothiazine derivative, which contributes to its unique properties. The presence of the oxido group indicates that it may exhibit specific reactivity or stability under certain conditions. Typically, compounds of this nature can display biological activity, making them of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The phenothiazine structure is known for its applications in antipsychotic medications and as dyes, suggesting potential therapeutic uses. Additionally, the trimethyl substitution may influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in both chemical and biological contexts.
Formula:C18H22N2OS
InChI:InChI=1/C18H22N2OS/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)22(21)18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3
SMILES:CC(CN(C)C)CN1c2ccccc2S(=O)c2ccccc12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.