CymitQuimica logo

CAS 100710-37-0

:

2-(2-Naphthalenyl)pyrrolidine

Description:
2-(2-Naphthalenyl)pyrrolidine, with the CAS number 100710-37-0, is an organic compound characterized by its unique structure, which consists of a pyrrolidine ring substituted with a naphthalene moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential applications in various fields, including medicinal chemistry and materials science. The presence of the naphthalene group imparts significant hydrophobic characteristics, while the pyrrolidine ring can participate in hydrogen bonding and other interactions due to its nitrogen atom. As a result, 2-(2-Naphthalenyl)pyrrolidine may exhibit interesting biological activities, making it a subject of interest in drug discovery. Additionally, its molecular structure suggests potential for engaging in π-π stacking interactions, which can be relevant in the design of organic electronic materials. Overall, the compound's unique combination of structural features positions it as a valuable candidate for further research and development in various chemical applications.
Formula:C14H15N
InChI:InChI=1S/C14H15N/c1-2-5-12-10-13(8-7-11(12)4-1)14-6-3-9-15-14/h1-2,4-5,7-8,10,14-15H,3,6,9H2
InChI key:InChIKey=ASDMHFSTBKLKST-UHFFFAOYSA-N
SMILES:C1(=CC2=C(C=C1)C=CC=C2)C3CCCN3
Synonyms:
  • 2-(2-Naphthalenyl)pyrrolidine
  • Pyrrolidine, 2-(2-naphthalenyl)-
  • 2-(2-Naphthyl)pyrrolidine
  • 2-(β-Naphthyl)pyrrolidine
  • Pyrrolidine, 2-(2-naphthyl)-
Found 2 products.