CymitQuimica logo

CAS 1007125-14-5

:

Cyclopentanemethanol,3-hydroxy-, (1S,3S)-

Description:
Cyclopentanemethanol, 3-hydroxy-, (1S,3S)- is a chiral organic compound characterized by a cyclopentane ring with a hydroxymethyl group and a hydroxyl group positioned at the 3rd carbon. Its molecular structure features a five-membered carbon ring, which contributes to its unique physical and chemical properties. The presence of the hydroxyl (-OH) groups indicates that it is likely to exhibit hydrogen bonding, influencing its solubility in polar solvents such as water and its reactivity in various chemical reactions. The specific stereochemistry, denoted by (1S,3S), suggests that the compound has two chiral centers, which can affect its biological activity and interactions with other molecules. Cyclopentanemethanol derivatives may find applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to their potential functional properties. As with many organic compounds, its stability, reactivity, and interactions can be influenced by environmental factors such as temperature and pH.
Formula:C6H12O2
InChI:InChI=1S/C6H12O2/c7-4-5-1-2-6(8)3-5/h5-8H,1-4H2/t5-,6-/m0/s1
InChI key:ZBAXTIFHKIGLEJ-WDSKDSINSA-N
SMILES:C1C[C@@H](C[C@H]1CO)O
Found 5 products.