CymitQuimica logo

CAS 1007207-67-1

:

CH5132799

Description:
CH5132799, also known by its CAS number 1007207-67-1, is a chemical compound that has garnered attention in pharmaceutical research, particularly for its potential therapeutic applications. It is characterized by its specific molecular structure, which includes various functional groups that contribute to its biological activity. The compound is typically studied for its role in modulating certain biological pathways, making it of interest in the development of treatments for various diseases. Its solubility, stability, and reactivity are important factors that influence its efficacy and safety profile in biological systems. Additionally, CH5132799 may undergo various metabolic processes in the body, which can affect its pharmacokinetics and pharmacodynamics. As with many compounds in drug development, understanding its interactions with biological targets and its overall mechanism of action is crucial for assessing its potential as a therapeutic agent. Further research and clinical studies are often necessary to fully elucidate its properties and applications in medicine.
Formula:C15H19N7O3S
InChI:InChI=1S/C15H19N7O3S/c1-26(23,24)22-3-2-11-12(10-8-17-14(16)18-9-10)19-15(20-13(11)22)21-4-6-25-7-5-21/h8-9H,2-7H2,1H3,(H2,16,17,18)
InChI key:JEGHXKRHKHPBJD-UHFFFAOYSA-N
SMILES:CS(=O)(=O)N1CCC2=C(N=C(N=C21)N3CCOCC3)C4=CN=C(N=C4)N
Found 5 products.