CymitQuimica logo

CAS 1007308-74-8

:

7-fluoro-6-nitroquinazoline-2,4(1H,3H)-dione

Description:
7-Fluoro-6-nitroquinazoline-2,4(1H,3H)-dione is a synthetic organic compound belonging to the quinazoline family, characterized by its fused bicyclic structure. This compound features a fluorine atom and a nitro group, which contribute to its unique chemical properties and potential biological activities. The presence of the nitro group typically enhances the compound's reactivity and may influence its pharmacological profile. As a quinazoline derivative, it may exhibit various biological activities, including antimicrobial, anticancer, or anti-inflammatory effects, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Its molecular structure suggests potential for hydrogen bonding and π-π stacking interactions, which could be relevant in drug design and development. Safety and handling precautions should be observed due to the presence of the nitro group, which can be associated with toxicity. Overall, 7-fluoro-6-nitroquinazoline-2,4(1H,3H)-dione represents a valuable compound for research in both synthetic and medicinal chemistry.
Formula:C8H4FN3O4
InChI:InChI=1S/C8H4FN3O4/c9-4-2-5-3(1-6(4)12(15)16)7(13)11-8(14)10-5/h1-2H,(H2,10,11,13,14)
InChI key:LXSGVXDLSKJWDH-UHFFFAOYSA-N
SMILES:C1=C2C(=CC(=C1[N+](=O)[O-])F)NC(=O)NC2=O
Found 1 products.