CAS 1007377-55-0

Glycine, N-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]-

Description:

Glycine, N-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]- is a chemical compound characterized by its unique structure, which includes a glycine moiety linked to a pyridine derivative. This compound features a 3-fluorophenyl group and a hydroxyl group, contributing to its potential biological activity. The presence of the carbonyl group indicates that it may participate in various chemical reactions, such as amide bond formation. Glycine itself is the simplest amino acid, known for its role in protein synthesis and as a neurotransmitter. The specific substitution patterns in this compound suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. Its molecular interactions may be influenced by the fluorine atom, which can enhance lipophilicity and alter biological activity. Overall, this compound exemplifies the complexity and diversity of chemical structures that can arise from modifications of simple amino acids, potentially leading to novel therapeutic agents.

Formula: C₁₄H₁₁FN₂O₄

InChI: InChI=1S/C14H11FN2O4/c15-10-3-1-2-8(4-10)9-5-11(18)13(16-6-9)14(21)17-7-12(19)20/h1-6,18H,7H2,(H,17,21)(H,19,20)

InChI key: PXWOWORYDKAEJO-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)F)C2=CC(=C(N=C2)C(=O)NCC(=O)O)O

Synonyms:

• AKB6899
• Glycine, N-[[5-(3-fluorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]-
• AKB-6899
• AKB 6899
• antiangiogenic,Inhibitor,AKB 6899,antitumor,AKB-6899,HIF-PH,HIF-2α,sVEGFR-1,HIF/HIF Prolyl-Hydroxylase,HIFs,inhibit,Hypoxia-inducible factors,PHD3

AKB-6899

CAS: 1007377-55-0

AKB-6899

Formula: C₁₄H₁₁FN₂O₄

Purity: 97.5%

Molecular weight: 290.25

Ref: 54-BUP16209

AKB-6899

CAS: 1007377-55-0

Purity: 97.87%

Ref: IN-DA0201AI

AKB-6899

CAS: 1007377-55-0

AKB-6899 is a medicinal compound that has been shown to induce apoptosis, or programmed cell death, in human cancer cells. It works by inhibiting kinase activity, which is involved in many cellular processes such as cell cycle regulation and protein synthesis. AKB-6899 is an analog of Chinese herbal medicine and has been studied extensively as a potential anticancer agent. In preclinical studies, this compound has demonstrated potent tumor growth inhibition in various types of cancer cells including breast, lung, and prostate cancer. AKB-6899 also shows promising results as a urine biomarker for early detection of kidney cancer. As a kinase inhibitor, it offers great potential for the development of new targeted therapies against cancer.

Formula: C₁₄H₁₁FN₂O₄

Purity: Min. 95%

Molecular weight: 290.25 g/mol

Ref: 3D-HQB37755

AKB-6899

CAS: 1007377-55-0

AKB-6899 is an inhibitor of prolyl hydroxylase domain 3 (PHD3) and increases the soluble form of the VEGF receptor (sVEGFR-1) production from GM-CSF-treated

Formula: C₁₄H₁₁FN₂O₄

Purity: 97.87%

Color and Shape: Solid

Molecular weight: 290.2465

Ref: TM-T29797