CymitQuimica logo

CAS 1007455-25-5

:

5-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one

Description:
5-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one is a chemical compound characterized by its unique isoindole structure, which features a fused bicyclic system. The presence of a fluorine atom at the 5-position and a hydroxyl group at the 6-position contributes to its distinct chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, owing to its functional groups. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in pharmacokinetics. Overall, 5-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one represents a valuable scaffold for further research in the fields of organic synthesis and pharmaceutical applications.
Formula:C8H6FNO2
InChI:InChI=1S/C8H6FNO2/c9-6-1-4-3-10-8(12)5(4)2-7(6)11/h1-2,11H,3H2,(H,10,12)
InChI key:InChIKey=XDCZVYFOCSBMCW-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(F)=C(O)C2)CN1
Synonyms:
  • 1H-Isoindol-1-one, 5-fluoro-2,3-dihydro-6-hydroxy-
  • 5-Fluoro-2,3-dihydro-6-hydroxy-1H-isoindol-1-one
  • 5-Fluoro-6-hydroxy-2,3-dihydroisoindol-1-one
Found 4 products.