CAS 10075-78-2
:2,7-BIS-(METHYLTHIO)NAPHTHALENE
Description:
2,7-Bis(methylthio)naphthalene, with the CAS number 10075-78-2, is an organic compound characterized by its naphthalene backbone substituted with two methylthio groups at the 2 and 7 positions. This compound typically appears as a solid at room temperature and is known for its aromatic properties, which contribute to its stability and potential applications in organic synthesis and materials science. The presence of methylthio groups enhances its solubility in organic solvents and may influence its electronic properties, making it of interest in the development of organic semiconductors or as a building block in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting photophysical properties, which could be leveraged in various applications, including dyes or sensors. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C12H12S2
InChI:InChI=1/C12H12S2/c1-13-11-5-3-9-4-6-12(14-2)8-10(9)7-11/h3-8H,1-2H3
SMILES:CSc1ccc2ccc(cc2c1)SC
Synonyms:- 2,7-Bis(Methylsulfanyl)Naphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,7-bis(methylthio)naphthalene
CAS:2,7-bis(methylthio)naphthaleneFormula:C12H12S2Molecular weight:220.35


