CAS 100750-40-1
:3-HYDROXY-5-PHENYLPYRROLE
Description:
3-Hydroxy-5-phenylpyrrole is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a hydroxyl group (-OH) at the 3-position and a phenyl group at the 5-position of the pyrrole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of dyes, pharmaceuticals, and as a building block in organic chemistry. Its reactivity can be influenced by the electron-donating nature of the phenyl group and the electron-withdrawing characteristics of the nitrogen atom in the pyrrole ring. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in medicinal chemistry. Proper handling and safety measures should be observed, as with all chemical substances.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c12-9-6-10(11-7-9)8-4-2-1-3-5-8/h1-7,11-12H
InChI key:BMJFHUYFKGXBCA-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=CN2)O
Synonyms:- Hoppy
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Hydroxy-5-phenylpyrrole
CAS:Stability Air Sensitive
Applications Used for detecting the presence of hydrolytic analytes, such as leukocytes, esterase, and protease. The detection of leukocytes is especially important in medical diagnostics.
References Jackson, D.S., et al.: Arch. Biochem. Biophys., 20, 323(1), 108 (1995)Formula:C10H9NOColor and Shape:NeatMolecular weight:159.18

