CymitQuimica logo

CAS 1007597-56-9

:

5,5′-(1E)-1,2-Diazenediylbis[1,3-benzenedicarboxylic acid]

Description:
5,5′-(1E)-1,2-Diazenediylbis[1,3-benzenedicarboxylic acid], also known by its CAS number 1007597-56-9, is an organic compound characterized by its azo functional group, which consists of a nitrogen-nitrogen double bond. This compound features two 1,3-benzenedicarboxylic acid moieties linked by a diazene bridge, contributing to its potential applications in various fields, including materials science and organic synthesis. The presence of carboxylic acid groups imparts acidic properties, allowing for potential interactions with metal ions and other substrates. The compound is likely to exhibit solubility in polar solvents due to its functional groups, while its structural rigidity may influence its thermal and mechanical properties. Additionally, the azo linkage can impart color and may be involved in photochemical reactions. Overall, this compound's unique structure and functional groups make it a subject of interest for research in coordination chemistry and the development of novel materials.
Formula:C16H10N2O8
InChI:InChI=1S/C16H10N2O8/c19-13(20)7-1-8(14(21)22)4-11(3-7)17-18-12-5-9(15(23)24)2-10(6-12)16(25)26/h1-6H,(H,19,20)(H,21,22)(H,23,24)(H,25,26)/b18-17+
InChI key:InChIKey=MXBBZODCMBYDCL-ISLYRVAYSA-N
SMILES:C(O)(=O)C1=CC(C(O)=O)=CC(/N=N/C2=CC(C(O)=O)=CC(C(O)=O)=C2)=C1
Synonyms:
  • 5,5′-(1E)-1,2-Diazenediylbis[1,3-benzenedicarboxylic acid]
  • 1,3-Benzenedicarboxylic acid, 5,5′-(1E)-1,2-diazenediylbis-
Found 3 products.