
CAS 1007859-25-7
:Chlorahololide C
Description:
Chlorahololide C is a natural compound classified as a chlorinated sesquiterpene, primarily derived from marine organisms, particularly certain species of algae. It exhibits a complex molecular structure characterized by multiple rings and functional groups, which contribute to its unique chemical properties. The presence of chlorine atoms in its structure is significant, as it can influence the compound's reactivity and biological activity. Chlorahololide C has garnered interest in the field of medicinal chemistry due to its potential bioactive properties, including antimicrobial and anticancer activities. Its mechanism of action and specific interactions with biological targets are areas of ongoing research. Additionally, the compound's solubility and stability can vary depending on environmental conditions, which is crucial for its application in pharmaceuticals and biochemistry. As with many natural products, the extraction and purification processes are essential for obtaining Chlorahololide C in sufficient quantities for study and potential therapeutic use.
Formula:C33H36O9
InChI:InChI=1S/C33H36O9/c1-11-15-8-16(15)30(5)19-10-32(39)18-9-17(18)31(6)26(32)23(20(24(35)27(31)36)12(2)28(37)40-7)33(19)22(13(3)29(38)42-33)25(21(11)30)41-14(4)34/h15-19,21,25,27,36,39H,1,8-10H2,2-7H3/b20-12-/t15-,16-,17-,18+,19+,21-,25-,27+,30-,31+,32+,33-/m1/s1
InChI key:FUWHPWXSVUDXDS-XMJAEXKHSA-N
SMILES:CC1=C2[C@@H]([C@H]3C(=C)[C@H]4C[C@H]4[C@@]3([C@H]5[C@@]2(C\6=C7[C@]([C@@H]8C[C@@H]8[C@]7(C5)O)([C@H](C(=O)/C6=C(/C)\C(=O)OC)O)C)OC1=O)C)OC(=O)C
Synonyms:- Chlorahololide C
- Propanoic acid, 2-[(1aR,1bS,2R,4bS,8R,8aS,9aS,10aR,10bS,10cS,11aS,11bS)-8-(acetyloxy)-1a,1b,2,3,6,8,8a,9,9a,10,10a,10b,10c,11,11a,11b-hexadecahydro-2,11a-dihydroxy-1b,7,10b-trimethyl-9-methylene-3,6-dioxocyclopropa[4,5]cyclopropa[4',5']cyclopent[1',2':7,8]acephenanthryleno[10a,10-b]furan-4(1H)-ylide...
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Chlorahololide C
CAS:Chlorahololide C blocks potassium channels, selectively inhibiting I(K) current with an IC50 of 3.6±10.1 µM.Formula:C33H36O9Purity:98%Color and Shape:SolidMolecular weight:576.63Chlorahololide C
CAS:Chlorahololide C is a bioactive compound, which is a natural product isolated from marine organisms, particularly soft corals and sponges. This compound exhibits a unique mode of action by interacting with cellular pathways that contribute to its potent anticancer and antiviral activities. It operates by disrupting specific protein functions and interfering with cellular replication mechanisms, thereby inhibiting tumor progression and viral proliferation.
Formula:C33H36O9Purity:Min. 95%Molecular weight:576.6 g/mol




